
CAS 1052545-58-0
:1H-Pyrazol-5-amine, 3-ethyl-1,4-dimethyl-, hydrochloride (1:1)
Description:
1H-Pyrazol-5-amine, 3-ethyl-1,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features an amine functional group, contributing to its basicity and potential reactivity. The presence of ethyl and methyl substituents on the pyrazole ring influences its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit specific pharmacological properties, potentially acting as a building block in drug development or as a research tool in biochemical studies. Its CAS number, 1052545-58-0, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound's unique structure and functional groups make it of interest in both synthetic and medicinal chemistry.
Formula:C7H13N3·ClH
InChI:InChI=1S/C7H13N3.ClH/c1-4-6-5(2)7(8)10(3)9-6;/h4,8H2,1-3H3;1H
InChI key:InChIKey=LUFBUUOMYMYVNR-UHFFFAOYSA-N
SMILES:C(C)C=1C(C)=C(N)N(C)N1.Cl
Synonyms:- 1H-Pyrazol-5-amine, 3-ethyl-1,4-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.