CAS 1052552-09-6

β,3,5-Trimethyl-1-piperidineethanamine

Description:

β,3,5-Trimethyl-1-piperidineethanamine is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of three methyl groups at the 3 and 5 positions of the piperidine ring contributes to its steric and electronic properties, potentially influencing its reactivity and interaction with biological systems. The ethylamine side chain enhances its basicity and solubility in polar solvents. This compound may exhibit properties typical of amines, such as being a nucleophile and participating in various chemical reactions, including alkylation and acylation. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. As with many amines, it may also be sensitive to oxidation and can form salts with acids, which can affect its stability and handling.

Formula: C₁₀H₂₂N₂

InChI: InChI=1S/C10H22N2/c1-8-4-9(2)7-12(6-8)10(3)5-11/h8-10H,4-7,11H2,1-3H3

InChI key: InChIKey=WGEAIYISKQEKLT-UHFFFAOYSA-N

SMILES: C(CN)(C)N1CC(C)CC(C)C1

Synonyms:

• β,3,5-Trimethyl-1-piperidineethanamine
• 1-Piperidineethanamine, β,3,5-trimethyl-