CAS 1052552-59-6

Imidazo[2,1-b]thiazole-6-methanamine, 2,3-dihydro-, hydrochloride (1:2)

Description:

Imidazo[2,1-b]thiazole-6-methanamine, 2,3-dihydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity, making it of interest in medicinal chemistry. The hydrochloride salt form indicates that it is a protonated version of the base compound, which often enhances solubility in aqueous solutions, facilitating its use in various applications, including pharmaceuticals. The presence of the methanamine group suggests potential reactivity and interaction with biological targets. Additionally, compounds of this nature may exhibit diverse pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would be necessary to confirm these effects. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or therapeutic contexts.

Formula: C₆H₉N₃S·2ClH

InChI: InChI=1S/C6H9N3S.2ClH/c7-3-5-4-9-1-2-10-6(9)8-5;;/h4H,1-3,7H2;2*1H

InChI key: InChIKey=LDGKQMMCIVOJLX-UHFFFAOYSA-N

SMILES: C(N)C=1N=C2N(C1)CCS2.Cl

Synonyms:

• Imidazo[2,1-b]thiazole-6-methanamine, 2,3-dihydro-, hydrochloride (1:2)

(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-ylmethyl)amine dihydrochloride

CAS: 1052552-59-6

Formula: C₆H₁₁Cl₂N₃S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 228.14

Ref: 10-F360965

{2H,3H-Imidazo[2,1-b][1,3]thiazol-6-yl}methanamine dihydrochloride

CAS: 1052552-59-6

Versatile small molecule scaffold

Formula: C₆H₁₁Cl₂N₃S

Purity: Min. 95%

Molecular weight: 228.14 g/mol

Ref: 3D-CSB55259