CAS 10526-80-4: 2-(phosphonooxy)acrylic acid, compound with cyclohexylamine (1:1)
Description:2-(Phosphonooxy)acrylic acid, compound with cyclohexylamine (1:1), is a chemical substance characterized by its phosphonate functional group, which imparts unique reactivity and properties. This compound typically exhibits both acidic and basic characteristics due to the presence of the acrylic acid moiety and the cyclohexylamine. The phosphonooxy group enhances its potential as a chelating agent and may facilitate interactions with metal ions, making it useful in various applications, including agriculture and pharmaceuticals. The cyclohexylamine component contributes to the compound's solubility and stability in organic solvents. Additionally, the structure suggests potential for polymerization, which could be exploited in material science. Overall, this compound's unique combination of functional groups allows for diverse applications, particularly in the development of agrochemicals and as a building block in organic synthesis. Its behavior in different environments, such as pH variations and solvent interactions, would be critical for understanding its reactivity and potential uses.
Formula:C9H18NO6P
InChI:InChI=1/C6H13N.C3H5O6P/c7-6-4-2-1-3-5-6;1-2(3(4)5)9-10(6,7)8/h6H,1-5,7H2;1H2,(H,4,5)(H2,6,7,8)
InChI key:InChIKey=VHFCNZDHPABZJO-UHFFFAOYSA-N
SMILES:O=C(O)C(OP(=O)(O)O)=C.NC1CCCCC1
- Synonyms:
- 2-(Phosphonooxy)Prop-2-Enoic Acid - Cyclohexanamine (1:1)
- 2-(Phosphonooxy)acrylic acid-cyclohexanamine (1:1)
- 2-Propenoic acid, 2-(phosphonooxy)-, compd. with cyclohexanamine (1:1)
- Acrylic acid, 2-hydroxy-, dihydrogen phosphate, compd. with cyclohexylamine (1:1)
- Cyclohexylamine, compd. with 2-hydroxyacrylic acid, di-H phosphate (1:1)
- Cyclohexylammonium phosphoenolpyruvate
