CAS 105263-07-8
:5-acetyl-2-amino-4-(4-methoxyphenyl)-6-methyl-4H-
Description:
5-Acetyl-2-amino-4-(4-methoxyphenyl)-6-methyl-4H-pyran-4-one, identified by the CAS number 105263-07-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyran ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic molecules with aromatic groups. The presence of functional groups like the acetyl and amino groups suggests potential reactivity, making it a candidate for various chemical reactions, including acylation and amination. Additionally, the methoxyphenyl substituent may impart specific electronic properties, influencing its reactivity and interactions with biological systems. Compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C16H16N2O3
InChI:InChI=1/C16H16N2O3/c1-9(19)14-10(2)21-16(18)13(8-17)15(14)11-4-6-12(20-3)7-5-11/h4-7,15H,18H2,1-3H3
SMILES:CC(=O)C1=C(C)OC(=C(C#N)C1c1ccc(cc1)OC)N
Synonyms:- 5-Acetyl-2-amino-4-(4-methoxyphenyl)-6-methyl-4H-pyran-3-carbon
- 5-acetyl-2-amino-4-(4-methoxyphenyl)-6-methyl-4H-pyran-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.