CAS 1052686-61-9

3-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine

Description:

3-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its steric properties, influencing its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the presence of both polar (nitro and amino) and nonpolar (tert-butyl) functional groups. It may participate in various chemical reactions typical of aromatic amines, such as electrophilic substitution, and can serve as an intermediate in the synthesis of more complex molecules. The bromine and fluorine substituents can also impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique functional groups and structure make it of interest in both synthetic organic chemistry and potential pharmaceutical applications.

Formula: C₁₀H₁₂BrFN₂O₂

InChI: InChI=1S/C10H12BrFN2O2/c1-10(2,3)13-8-5-6(12)4-7(11)9(8)14(15)16/h4-5,13H,1-3H3

InChI key: InChIKey=IFLUDTBJYRREBV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NC(C)(C)C)C=C(F)C=C1Br

Synonyms:

• 3-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine
• Benzenamine, 3-bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitro-