
CAS 10527-47-6
:P1-Adenosine-5′ P3-guanosine-5′ triphosphate
Description:
P1-Adenosine-5′ P3-guanosine-5′ triphosphate, commonly referred to as Ap3A, is a nucleotide that plays a significant role in cellular signaling and energy transfer. It is a dinucleotide composed of two nucleoside triphosphates: adenosine and guanosine, linked by a phosphoanhydride bond. Ap3A is known for its involvement in various biochemical processes, including the regulation of enzyme activity and the modulation of cellular responses to stress. It acts as a signaling molecule, influencing pathways related to cell proliferation, differentiation, and apoptosis. The compound is typically found in low concentrations within cells and can be synthesized enzymatically or through chemical methods. Its stability is influenced by environmental factors such as pH and temperature, and it can be hydrolyzed by specific enzymes, which is crucial for its regulatory functions. Overall, P1-Adenosine-5′ P3-guanosine-5′ triphosphate is an important player in the complex network of cellular signaling and metabolism.
Formula:C20H27N10O17P3
InChI:InChI=1S/C20H27N10O17P3/c21-14-8-15(24-3-23-14)29(4-25-8)18-12(33)10(31)6(44-18)1-42-48(36,37)46-50(40,41)47-49(38,39)43-2-7-11(32)13(34)19(45-7)30-5-26-9-16(30)27-20(22)28-17(9)35/h3-7,10-13,18-19,31-34H,1-2H2,(H,36,37)(H,38,39)(H,40,41)(H2,21,23,24)(H3,22,27,28,35)/t6-,7-,10-,11-,12-,13-,18-,19-/m1/s1
InChI key:InChIKey=PMJUJCUPNRCBNP-INFSMZHSSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](COP(OP(OP(OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)N5C=6C(N=C5)=C(N)N=CN6)(=O)O)(=O)O)(=O)O)[C@H]1O
Synonyms:- Guanosine 5′-(tetrahydrogen triphosphate), 5′→5′-ester with adenosine
- Guanosine 5′-(tetrahydrogen triphosphate), P′′→5′-ester with adenosine
- Guanosine triphosphate, 5′→5′-ester with adenosine
- Adenosine 5′-(tetrahydrogen triphosphate), 5′→5′-ester with guanosine
- P1-Adenosine-5′ P3-guanosine-5′ triphosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Guanosine 5'-triphosphate-5'-adenosine
CAS:<p>Guanosine 5'-triphosphate-5'-adenosine, known as a 5′ cap analog, serves as a fluorescent substrate analog.</p>Formula:C20H27N10O17P3Color and Shape:SolidMolecular weight:772.41
