CAS 1052714-12-1

3′-Deoxy-4-O-methylepisappanol

Description:

3′-Deoxy-4-O-methylepisappanol is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities and potential health benefits. This substance is characterized by its unique structural features, including a methoxy group and a deoxy modification, which influence its solubility and reactivity. Flavonoids, in general, are recognized for their antioxidant properties, which can help mitigate oxidative stress in biological systems. The presence of specific functional groups in 3′-Deoxy-4-O-methylepisappanol may also contribute to its potential pharmacological effects, including anti-inflammatory and antimicrobial activities. Additionally, the compound's molecular structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry and natural product research. As with many flavonoids, further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential. Overall, 3′-Deoxy-4-O-methylepisappanol represents a fascinating area of study within the realm of bioactive natural products.

Formula: C₁₇H₁₈O₅

InChI: InChI=1S/C17H18O5/c1-21-16-14-7-6-13(19)8-15(14)22-10-17(16,20)9-11-2-4-12(18)5-3-11/h2-8,16,18-20H,9-10H2,1H3/t16-,17-/m1/s1

InChI key: InChIKey=NRDMATSOBGRQDO-IAGOWNOFSA-N

SMILES: O(C)[C@@H]1C=2C(OC[C@@]1(CC3=CC=C(O)C=C3)O)=CC(O)=CC2

Synonyms:

• 2H-1-Benzopyran-3,7-diol, 3,4-dihydro-3-[(4-hydroxyphenyl)methyl]-4-methoxy-, (3R,4R)-
• 3′-Deoxy-4-O-methylepisappanol
• (3R,4R)-3,4-Dihydro-3-[(4-hydroxyphenyl)methyl]-4-methoxy-2H-1-benzopyran-3,7-diol

3'-Deoxy-4-o-methylepisappanol

CAS: 1052714-12-1

3'-Deoxy-4-o-methylepisappanol is a natural compound, which is a lignan typically sourced from certain plant species. It possesses notable biological properties due to its unique chemical structure. The compound's mode of action involves interactions with specific cellular pathways, potentially influencing various biological processes through modulation of enzymatic activities and receptor bindings. This lignan's activity is of particular interest for its potential antioxidant and anti-inflammatory effects.

Formula: C₁₇H₁₈O₅

Purity: Min. 95%

Molecular weight: 302.32 g/mol

Ref: 3D-CSB71412