CAS 1052714-14-3
:3-Amino-6-bromo-5-fluoro-2-pyridinecarboxylic acid
Description:
3-Amino-6-bromo-5-fluoro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple functional groups, including an amino group (-NH2), a bromo substituent (-Br), and a fluoro substituent (-F), all of which contribute to its chemical reactivity and potential applications. The carboxylic acid group (-COOH) enhances its acidity and solubility in polar solvents. The presence of halogens (bromo and fluoro) can influence the compound's electronic properties, making it useful in various chemical syntheses and pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, which may be explored in drug development. Additionally, the compound's unique combination of substituents may impart specific characteristics such as increased lipophilicity or altered metabolic stability, making it a subject of interest in medicinal chemistry and material science.
Formula:C6H4BrFN2O2
InChI:InChI=1S/C6H4BrFN2O2/c7-5-2(8)1-3(9)4(10-5)6(11)12/h1H,9H2,(H,11,12)
InChI key:InChIKey=XJCGNMVYWONXCU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=C(F)C(Br)=N1
Synonyms:- 2-Pyridinecarboxylic acid, 3-amino-6-bromo-5-fluoro-
- 3-Amino-6-bromo-5-fluoropicolinic acid
- 3-Amino-6-bromo-5-fluoro-2-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.