CAS 1052714-46-1

6-Bromo-5-fluoropyridine-2-carboxylic acid

Description:

6-Bromo-5-fluoropyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group, at the 5-position with a fluorine atom, and at the 6-position with a bromine atom. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential reactivity in nucleophilic substitution reactions due to the presence of the electron-withdrawing halogen substituents. The presence of the bromine and fluorine atoms can influence the compound's electronic properties, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. Additionally, the carboxylic acid group can participate in hydrogen bonding, enhancing its interactions in biological systems. Overall, 6-Bromo-5-fluoropyridine-2-carboxylic acid is a valuable compound in research and development, particularly for its potential applications in drug discovery and material science.

Formula: C₆H₃BrFNO₂

InChI: InChI=1S/C6H3BrFNO2/c7-5-3(8)1-2-4(9-5)6(10)11/h1-2H,(H,10,11)

SMILES: c1cc(C(=O)O)nc(c1F)Br

Synonyms:

• 6-Bromo-5-fluoro-2-pyridinecarboxylic acid
• 6-BroMo-5-fluoropicolinic acid
• 2-Pyridinecarboxylic acid, 6-broMo-5-fluoro-

6-Bromo-5-fluoro-2-pyridinecarboxylic acid

CAS: 1052714-46-1

Formula: C₆H₃BrFNO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 219.9959

Ref: IN-DA0034CD

6-Bromo-5-fluoropicolinic acid

CAS: 1052714-46-1

6-Bromo-5-fluoropicolinic acid

Purity: 98%

Color and Shape: White Solid

Molecular weight: 220.00g/mol

Ref: 54-PC305018

6-Bromo-5-fluoropicolinic acid

CAS: 1052714-46-1

Formula: C₆H₃BrFNO₂

Purity: 95%

Color and Shape: Solid, Green powder

Molecular weight: 219.997

Ref: 10-F214907