
CAS 105279-10-5
:Citrusin B
Description:
Citrusin B, with the CAS number 105279-10-5, is a naturally occurring compound classified as a flavonoid. It is primarily derived from citrus fruits and is known for its potential health benefits, including antioxidant and anti-inflammatory properties. The structure of Citrusin B features a flavanone backbone, which is characteristic of many flavonoids, contributing to its biological activity. This compound has garnered interest in the field of nutraceuticals due to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, Citrusin B may exhibit antimicrobial properties, making it a subject of research for potential applications in food preservation and health supplements. Its solubility in organic solvents and limited solubility in water are typical for flavonoids, influencing its bioavailability and efficacy in biological systems. Overall, Citrusin B represents a significant area of study within phytochemistry and pharmacognosy, highlighting the importance of plant-derived compounds in health and disease management.
Formula:C27H36O13
InChI:InChI=1S/C27H36O13/c1-35-17-11-15(6-7-16(17)39-27-25(34)24(33)23(32)21(13-30)40-27)22(31)20(12-29)38-26-18(36-2)9-14(5-4-8-28)10-19(26)37-3/h4-7,9-11,20-25,27-34H,8,12-13H2,1-3H3/b5-4+/t20-,21-,22+,23-,24+,25-,27-/m1/s1
InChI key:InChIKey=XMGKCJUCYBLMBY-OGVRJPSHSA-N
SMILES:O([C@@H]([C@@H](O)C1=CC(OC)=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C1)CO)C3=C(OC)C=C(/C=C/CO)C=C3OC
Synonyms:- β-D-Glucopyranoside, 4-[(1S,2R)-1,3-dihydroxy-2-[4-[(1E)-3-hydroxy-1-propenyl]-2,6-dimethoxyphenoxy]propyl]-2-methoxyphenyl
- Citrusin B
- β-D-Glucopyranoside, 4-[(1S,2R)-1,3-dihydroxy-2-[4-[(1E)-3-hydroxy-1-propen-1-yl]-2,6-dimethoxyphenoxy]propyl]-2-methoxyphenyl
- 4-[(1S,2R)-1,3-Dihydroxy-2-[4-[(1E)-3-hydroxy-1-propen-1-yl]-2,6-dimethoxyphenoxy]propyl]-2-methoxyphenyl β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Citrusin B
CAS:<p>Citrusin B is a biosurfactant, which is a surface-active compound derived from natural biological sources, specifically microorganisms. This product is primarily obtained through the fermentation processes of certain bacterial species, known for their ability to produce efficient and biodegradable surfactants. The mode of action involves reducing surface and interfacial tension between liquids, or between a liquid and a solid. This characteristic facilitates the emulsification, foaming, and dispersion of insoluble substances, enhancing chemical reactions or processes where interfaces are involved.</p>Formula:C27H36O13Purity:Min. 95%Molecular weight:568.60 g/mol
