CAS 10528-64-0
:4-[4-(1-Methylethyl)phenyl]-2-butanone
Description:
4-[4-(1-Methylethyl)phenyl]-2-butanone, also known as 4-(p-Isopropylphenyl)-2-butanone, is an organic compound characterized by its ketone functional group and a branched alkyl substituent. It features a butanone backbone with a phenyl ring substituted at the para position by an isopropyl group, which contributes to its hydrophobic nature. This compound is typically a colorless to pale yellow liquid with a distinctive odor, making it relevant in the fragrance and flavor industry. Its molecular structure allows for potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the isopropyl group enhances its stability and influences its reactivity, making it a subject of interest in studies related to chemical behavior and interactions. Additionally, safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C13H18O
InChI:InChI=1S/C13H18O/c1-10(2)13-8-6-12(7-9-13)5-4-11(3)14/h6-10H,4-5H2,1-3H3
InChI key:InChIKey=URPGTYOPLRABIL-UHFFFAOYSA-N
SMILES:C(C)(C)C1=CC=C(CCC(C)=O)C=C1
Synonyms:- 2-Butanone, 4-[4-(1-methylethyl)phenyl]-
- (p-Isopropylbenzyl)acetone
- 4-[4-(1-Methylethyl)phenyl]-2-butanone
- 4-(4-Isopropylphenyl)butan-2-one
- 2-Butanone, 4-p-cumenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
