CAS 105284-17-1
:dihydrotetramethylrosamine
Description:
Dihydrotetramethylrosamine, identified by its CAS number 105284-17-1, is a synthetic chemical compound primarily used as a fluorescent dye. This substance is characterized by its ability to emit fluorescence upon excitation, making it valuable in various biological and chemical applications, particularly in imaging and labeling techniques. Dihydrotetramethylrosamine exhibits a strong affinity for binding to specific biological targets, which enhances its utility in cellular and molecular biology research. The compound is typically soluble in organic solvents and may have limited solubility in water, depending on its specific formulation. Its structural features include multiple methyl groups and a nitrogen-containing heterocyclic ring, contributing to its stability and photophysical properties. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage in laboratory settings. Overall, dihydrotetramethylrosamine is a versatile tool in scientific research, particularly in studies involving fluorescence microscopy and flow cytometry.
Formula:C23H24N2O
InChI:InChI=1/C23H24N2O/c1-24(2)17-10-12-19-21(14-17)26-22-15-18(25(3)4)11-13-20(22)23(19)16-8-6-5-7-9-16/h5-15,23H,1-4H3
SMILES:CN(C)c1ccc2c(c1)Oc1cc(ccc1C2c1ccccc1)N(C)C
Synonyms:- Dhtm ros
- 9H-Xanthene-3,6-diamine, N,N,N',N'-tetramethyl-9-phenyl-
- N,N,N',N'-tetramethyl-9-phenyl-9H-xanthene-3,6-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.