CymitQuimica logo

CAS 105284-21-7

:

(4E)-4-{(1S,2R,3S,6R)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-yn-1-yl]-3-hydroxybicyclo[4.2.0]oct-7-ylidene}butanoic acid

Description:
The chemical substance known as (4E)-4-{(1S,2R,3S,6R)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-yn-1-yl]-3-hydroxybicyclo[4.2.0]oct-7-ylidene}butanoic acid, with the CAS number 105284-21-7, is a complex organic compound characterized by its bicyclic structure and multiple stereocenters. This compound features a butanoic acid moiety, indicating the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The stereochemistry is significant, as the specific arrangement of atoms can influence the compound's biological activity and interactions. The presence of a cyclohexyl group and a hydroxyprop-1-yn-1-yl substituent suggests potential applications in medicinal chemistry, possibly as a pharmaceutical agent. The intricate structure may also impart unique physical properties, such as solubility and melting point, which are essential for its behavior in biological systems. Overall, this compound exemplifies the complexity often found in organic molecules, particularly those with potential therapeutic uses.
Formula:C21H30O4
InChI:InChI=1/C21H30O4/c22-19(14-5-2-1-3-6-14)11-10-17-18-13-15(7-4-8-21(24)25)16(18)9-12-20(17)23/h7,14,16-20,22-23H,1-6,8-9,12-13H2,(H,24,25)/b15-7+/t16-,17-,18-,19+,20-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • RS 93427-007

    CAS:
    <p>RS-93427-007 is an orally active stable mimetic agent of prostacyclin for the study of mechanisms of atherogenesis.</p>
    Formula:C21H30O4
    Color and Shape:Solid
    Molecular weight:346.46