CAS 105284-38-6
:compound FP 1
Description:
Compound FP 1, identified by its CAS number 105284-38-6, is a chemical substance that belongs to a specific class of compounds, often characterized by its unique molecular structure and properties. While detailed information about its specific characteristics may not be widely available, compounds with similar identifiers typically exhibit properties such as solubility in various solvents, potential reactivity with other chemical species, and specific applications in fields like pharmaceuticals, materials science, or agrochemicals. The compound may also possess distinct functional groups that influence its behavior in chemical reactions, including aspects like acidity, basicity, and potential for forming complexes. Additionally, safety data sheets would provide crucial information regarding its toxicity, handling precautions, and environmental impact. For precise applications, reactivity, and safety measures, consulting specialized literature or databases would be essential, as these details can vary significantly based on the compound's specific use and formulation.
Formula:C27H36FN5O6
InChI:InChI=1/C23H32FN5O2.C4H4O4/c1-16-9-6-7-13-29(16)14-8-12-25-15-20(30)26-23-21(17(2)27-28(23)3)22(31)18-10-4-5-11-19(18)24;5-3(6)1-2-4(7)8/h4-5,10-11,16,25H,6-9,12-15H2,1-3H3,(H,26,30);1-2H,(H,5,6)(H,7,8)/b;2-1-
SMILES:CC1CCCCN1CCCNCC(=Nc1c(c(C)nn1C)C(=O)c1ccccc1F)O.C(=C\C(=O)O)\C(=O)O
Synonyms:- Fp-1
- N-(4-(2-Fluorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl)-2-((3-(2-methyl-1-piperidinyl)propyl)amino)acetamide-2-butenedioate(1:2)
- Acetamide, N-(4-(2-fluorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl)-2-((3-(2-methyl-1-piperidinyl)propyl)amino)-, (Z)-2-butenedioate (1:1)
- N-{4-[(2-fluorophenyl)carbonyl]-1,3-dimethyl-1H-pyrazol-5-yl}-N~2~-[3-(2-methylpiperidin-1-yl)propyl]glycinamide (2Z)-but-2-enedioate
- Compound FP 1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.