
CAS 105294-95-9
:N4-Ethyl-2-methyl-1,4-benzenediamine
Description:
N4-Ethyl-2-methyl-1,4-benzenediamine, also known by its CAS number 105294-95-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two amino groups and an ethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethyl and methyl groups contributes to its hydrophobic characteristics, potentially affecting its reactivity and interaction with other chemical species. N4-Ethyl-2-methyl-1,4-benzenediamine may be used in various applications, including as a precursor in the synthesis of dyes, polymers, or other organic compounds. Safety data should be consulted for handling, as amines can be hazardous, and appropriate precautions should be taken to mitigate exposure. Overall, this compound's unique structure and functional groups make it a subject of interest in organic chemistry and materials science.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-3-11-8-4-5-9(10)7(2)6-8/h4-6,11H,3,10H2,1-2H3
InChI key:InChIKey=OOMLOTQQQVXPLN-UHFFFAOYSA-N
SMILES:N(CC)C1=CC(C)=C(N)C=C1
Synonyms:- 1-N-Ethyl-3-methylbenzene-1,4-diamine
- 1,4-Benzenediamine, N4-ethyl-2-methyl-
- N4-Ethyl-2-methyl-1,4-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.