CAS 1053-73-2: Adenosine 3′,5′-diphosphate
Description:Adenosine 3′,5′-diphosphate (ADP) is a nucleotide that plays a crucial role in cellular energy transfer and metabolism. It consists of an adenosine molecule linked to two phosphate groups, which are connected by high-energy bonds. ADP is involved in various biochemical processes, including the synthesis of adenosine triphosphate (ATP), the primary energy currency of the cell. When energy is required, ADP can be phosphorylated to form ATP, while the reverse reaction occurs during energy release. ADP is also a key player in signal transduction pathways and is involved in the regulation of various enzymatic activities. In terms of solubility, ADP is highly soluble in water, which facilitates its role in cellular processes. Its structure allows it to participate in hydrogen bonding and ionic interactions, making it essential for its biological functions. The CAS number 1053-73-2 uniquely identifies this compound, ensuring precise reference in scientific literature and databases. Overall, ADP is vital for energy metabolism and cellular signaling in living organisms.
Formula:C10H15N5O10P2
InChI:InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7(25-27(20,21)22)4(24-10)1-23-26(17,18)19/h2-4,6-7,10,16H,1H2,(H2,11,12,13)(H2,17,18,19)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=WHTCPDAXWFLDIH-KQYNXXCUSA-N
SMILES:O=P(O)(O)OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1OP(=O)(O)O
- Synonyms:
- (3S)-3-hydroxy-4-(trimethylammonio)butanoate
- 3′,5′-Adp
- 3′,5′-Diphosphoadenosine
- 3′-Adenylic acid, 5′-(dihydrogen phosphate)
- 3′-Phosphoadenosine-5′-phosphate
- 3′-Phosphoryl-AMP
- A 3P5P
- Adenosine 3',5'-Bis(Dihydrogen Phosphate)
- Adenosine 3',5'-diphosphate
- Adenosine 3'-Phosphate-5'-Phosphate
- See more synonyms
- Adenosine 3′,5′-bisphosphate
- Adenosine 3′,5′-diphosphate
- Adenosine, 3′,5′-bis(dihydrogen phosphate)
- Adenosine-3',5'-diphosphoric acid (and/or unspecified salts)

Ref: 4Z-A-267012
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Adenosine 3',5'-bisphosphate triethylammonium salt - 10mM aqueous solution
Ref: 3D-NA44795
Undefined size | To inquire |

Adenosine 3',5'-Bisphosphate Dicalcium Hydrate
Controlled ProductRef: TR-A280490
250mg | 3,864.00 € |