CAS 10531-41-6
:2-(2-BROMOACETYL)THIOPHENE
Description:
2-(2-Bromoacetyl)thiophene is an organic compound characterized by the presence of a thiophene ring substituted with a bromoacetyl group. This compound features a five-membered aromatic ring containing sulfur, which contributes to its unique electronic properties. The bromoacetyl substituent introduces both a halogen and a carbonyl functionality, enhancing its reactivity and potential for further chemical transformations. Typically, compounds like this exhibit moderate to high solubility in organic solvents due to their polar functional groups, while their aromatic nature may confer stability and distinct spectral properties. The presence of the bromine atom can also facilitate nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Overall, 2-(2-Bromoacetyl)thiophene serves as a valuable building block in the synthesis of more complex molecules and materials in various chemical research applications.
Formula:C6H5BrOS
InChI:InChI=1/C6H5BrOS/c7-4-5(8)6-2-1-3-9-6/h1-3H,4H2
SMILES:c1cc(C(=O)CBr)sc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Bromoacetyl)thiophene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H5BrOSPurity:97%Molecular weight:205.07Ethanone, 2-bromo-1-(2-thienyl)-
CAS:Formula:C6H5BrOSPurity:97%Color and Shape:SolidMolecular weight:205.07232-(Bromoacetyl)thiophene
CAS:2-(Bromoacetyl)thiopheneFormula:C6H5BrOSPurity:97%Color and Shape: off white/cream crystalline needlesMolecular weight:205.07g/mol2-Bromo-1-(thiophen-2-yl)ethanone
CAS:Formula:C6H5BrOSPurity:95%Color and Shape:SolidMolecular weight:205.07



