
CAS 10531-42-7
:2-Bromo-1-(5-methyl-2-thienyl)ethanone
Description:
2-Bromo-1-(5-methyl-2-thienyl)ethanone is an organic compound characterized by its bromine and thienyl functional groups. It features a thienyl ring, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various organic synthesis reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in chemical reactions. The compound's structure suggests potential applications in pharmaceuticals and agrochemicals, particularly in the development of biologically active molecules. Safety considerations are important when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken. Overall, 2-Bromo-1-(5-methyl-2-thienyl)ethanone is a valuable compound in synthetic organic chemistry, with properties that lend themselves to further exploration in various chemical applications.
Formula:C7H7BrOS
InChI:InChI=1S/C7H7BrOS/c1-5-2-3-7(10-5)6(9)4-8/h2-3H,4H2,1H3
InChI key:InChIKey=WIEZPKHDQRZMCI-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C=1SC(C)=CC1
Synonyms:- Ketone, bromomethyl 5-methyl-2-thienyl
- 2-Bromo-1-(5-methyl-2-thienyl)ethanone
- α-Bromomethyl 5-methyl-2-thienyl ketone
- Ethanone, 2-bromo-1-(5-methyl-2-thienyl)-
- 2-Bromoacetyl-5-methylthiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
