CAS 10531-43-8

2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone

Description:

2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone is an organic compound characterized by its unique structure, which includes a bromine atom, a thienyl group, and a ketone functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and can influence its electronic characteristics, enhancing its potential applications in organic electronics or as a building block in synthetic chemistry. The phenyl group adds to the compound's stability and can also participate in π-π stacking interactions, which may be beneficial in material science. Additionally, the ketone functional group is known for its reactivity in condensation reactions and can serve as a site for further functionalization. Overall, 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone exhibits a combination of reactivity and stability, making it a versatile compound in organic synthesis and materials development.

Formula: C₁₂H₉BrOS

InChI: InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2

SMILES: c1ccc(cc1)c1ccc(C(=O)CBr)s1

Synonyms:

• 2-Bromo-1-(5-Phenylthiophen-2-Yl)Ethanone

2-(Bromoacetyl)-5-phenylthiophene

CAS: 10531-43-8

2-(Bromoacetyl)-5-phenylthiophene

Purity: ≥95%

Color and Shape: Yellow Solid

Molecular weight: 281.17g/mol

Ref: 54-OR23149