CymitQuimica logo

CAS 10531-78-9

:

5-Methylbenzoxazole;

Description:
5-Methylbenzoxazole is an organic compound characterized by its fused benzene and oxazole rings, which contribute to its aromatic properties and stability. It features a methyl group attached to the benzene ring, influencing its reactivity and solubility. This compound typically appears as a white to light yellow crystalline solid and is known for its moderate polarity, making it soluble in organic solvents while being less soluble in water. 5-Methylbenzoxazole exhibits interesting photophysical properties, often used in various applications, including as a fluorescent probe or in the synthesis of other chemical compounds. Its structure allows for potential interactions with biological systems, which has led to research into its pharmacological properties. The compound is also of interest in materials science for its potential use in organic electronics. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 5-Methylbenzoxazole is a versatile compound with applications in both research and industry.
Formula:C8H7NO
InChI:InChI=1/C8H7NO/c1-6-2-3-8-7(4-6)9-5-10-8/h2-5H,1H3
InChI key:InChIKey=UBIAVBGIRDRQLD-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CC1)OC=N2
Synonyms:
  • 5-Methyl-1,3-Benzoxazole
  • Benzoxazole, 5-methyl-
  • 5-Methylbenzoxazole
  • 5-Methylbenzoxazole, 99.5+%
Found 6 products.