CAS 105315-49-9

2,5-Dichloro-4-methylthiazole

Description:

2,5-Dichloro-4-methylthiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. This compound features two chlorine substituents at the 2 and 5 positions and a methyl group at the 4 position of the thiazole ring. It is typically a colorless to pale yellow solid with a distinct odor. The presence of chlorine atoms contributes to its reactivity and potential applications in various chemical processes, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The thiazole structure imparts certain biological activities, making it of interest in medicinal chemistry. Additionally, 2,5-Dichloro-4-methylthiazole is soluble in organic solvents, which can influence its behavior in different chemical environments. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, this compound exemplifies the diverse functionalities of halogenated heterocycles in organic chemistry.

Formula: C₄H₃Cl₂NS

InChI: InChI=1S/C4H3Cl2NS/c1-2-3(5)8-4(6)7-2/h1H3

InChI key: InChIKey=RBEKLBIOMLTMFQ-UHFFFAOYSA-N

SMILES: CC1=C(Cl)SC(Cl)=N1

Synonyms:

• Thiazole, 2,5-dichloro-4-methyl-
• 2,5-Dichloro-4-methyl-1,3-thiazole
• 2,5-Dichloro-4-methylthiazole