CymitQuimica logo

CAS 105316-99-2

:

5-(2-Amino-4-thiazolyl)-1,3-dihydro-2H-indol-2-one

Description:
5-(2-Amino-4-thiazolyl)-1,3-dihydro-2H-indol-2-one, with the CAS number 105316-99-2, is a chemical compound that features a complex structure incorporating an indole moiety and a thiazole ring. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties such as antimicrobial or anticancer effects. The presence of the amino and thiazole groups contributes to its reactivity and interaction with biological targets. It is typically synthesized through multi-step organic reactions, which may involve cyclization and functional group modifications. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many heterocyclic compounds, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its specific applications and efficacy in biological systems would require further investigation through experimental studies and clinical trials. Overall, this compound represents a significant interest in the field of pharmaceutical chemistry due to its structural features and potential therapeutic applications.
Formula:C11H9N3OS
InChI:InChI=1S/C11H9N3OS/c12-11-14-9(5-16-11)6-1-2-8-7(3-6)4-10(15)13-8/h1-3,5H,4H2,(H2,12,14)(H,13,15)
InChI key:InChIKey=YRPIIMJICPLJAO-UHFFFAOYSA-N
SMILES:O=C1CC=2C(=CC=C(C2)C3=CSC(N)=N3)N1
Synonyms:
  • 5-(2-Amino-4-thiazolyl)-1,3-dihydro-2H-indol-2-one
  • 2H-Indol-2-one, 5-(2-amino-4-thiazolyl)-1,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.