CAS 105321-50-4
:1-(3,4-diethoxyphenyl)ethanamine
Description:
1-(3,4-Diethoxyphenyl)ethanamine, with the CAS number 105321-50-4, is an organic compound characterized by its amine functional group and a substituted phenyl ring. This compound features two ethoxy groups attached to the aromatic ring, which significantly influences its solubility and reactivity. The presence of the ethanamine moiety suggests potential biological activity, as amines are often involved in various biochemical processes. The diethoxy substitution can enhance lipophilicity, potentially affecting its interaction with biological membranes. Additionally, the compound may exhibit properties such as moderate volatility and stability under standard conditions, although specific reactivity can depend on the surrounding environment. Its structural characteristics may allow for applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. However, detailed studies would be necessary to fully understand its properties, including its melting point, boiling point, and specific reactivity patterns. Safety data and handling precautions should also be considered when working with this compound in a laboratory setting.
Formula:C12H19NO2
InChI:InChI=1/C12H19NO2/c1-4-14-11-7-6-10(9(3)13)8-12(11)15-5-2/h6-9H,4-5,13H2,1-3H3
InChI key:InChIKey=OXUSXEBIIDKQFW-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(C(C)N)=C1
Synonyms:- 1-(3,4-Diethoxy-phenyl)-ethylamine
- 1-(3,4-Diethoxyphenyl)ethan-1-amine
- 3,4-Diethoxy-α-methylbenzenemethanamine
- Benzenemethanamine, 3,4-Diethoxy-Alpha-Methyl-
- Benzenemethanamine, 3,4-diethoxy-α-methyl-
- 1-(3,4-Diethoxyphenyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.