CAS 105321-54-8
:1-(4-Chloro-3-methylphenyl)-1-propanone
Description:
1-(4-Chloro-3-methylphenyl)-1-propanone, also known by its CAS number 105321-54-8, is an organic compound characterized by its ketone functional group. It features a propanone backbone with a 4-chloro-3-methylphenyl substituent, indicating the presence of a chlorine atom and a methyl group on the aromatic ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The presence of the chloro and methyl groups can influence its reactivity and solubility, making it a useful intermediate in various chemical reactions. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c1-3-10(12)8-4-5-9(11)7(2)6-8/h4-6H,3H2,1-2H3
InChI key:InChIKey=GLACWDSQAVVCAU-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC(C)=C(Cl)C=C1
Synonyms:- 1-(4-Chloro-3-methylphenyl)propan-1-one
- 4′-Chloro-3′-methylpropiophenone
- 1-Propanone, 1-(4-chloro-3-methylphenyl)-
- 1-(4-Chloro-3-methylphenyl)-1-propanone
- 3′-Methyl-4′-chloropropiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Chloro-3-methylphenyl)-1-propanone
CAS:Formula:C10H11ClOColor and Shape:SolidMolecular weight:182.6467
