CymitQuimica logo

CAS 105326-62-3

:

2-(pyridin-2-ylmethoxy)aniline

Description:
2-(Pyridin-2-ylmethoxy)aniline, with the CAS number 105326-62-3, is an organic compound characterized by its structure, which includes a pyridine ring and an aniline moiety connected by a methoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the amine and ether functional groups. The pyridine ring contributes to its aromatic character, while the aniline part can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 2-(pyridin-2-ylmethoxy)aniline is a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C12H12N2O
InChI:InChI=1/C12H12N2O/c13-11-6-1-2-7-12(11)15-9-10-5-3-4-8-14-10/h1-8H,9,13H2
SMILES:c1ccc(c(c1)N)OCc1ccccn1
Synonyms:
  • Benzenamine, 2-(2-Pyridinylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.