CAS 1053265-67-0

2-Bromo-5,5-dimethyl-1-cyclohexene-1-methanol

Description:

2-Bromo-5,5-dimethyl-1-cyclohexene-1-methanol is an organic compound characterized by its unique structure, which includes a cyclohexene ring with a bromine substituent and a hydroxymethyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, such as nucleophilic substitution reactions. The dimethyl groups contribute to steric hindrance, influencing the compound's reactivity and stability. This compound is likely to exhibit properties typical of both alcohols and alkenes, including solubility in polar solvents due to the hydroxyl group and potential participation in electrophilic addition reactions due to the double bond. Its molecular structure suggests that it may have applications in organic synthesis, particularly in the development of more complex molecules. Additionally, the presence of the cyclohexene moiety may impart unique conformational characteristics, affecting its physical properties such as boiling point and melting point. Overall, 2-Bromo-5,5-dimethyl-1-cyclohexene-1-methanol is a versatile compound with potential utility in various chemical applications.

Formula: C₉H₁₅BrO

InChI: InChI=1S/C9H15BrO/c1-9(2)4-3-8(10)7(5-9)6-11/h11H,3-6H2,1-2H3

InChI key: InChIKey=HDNZYMKCYWLHGA-UHFFFAOYSA-N

SMILES: C(O)C=1CC(C)(C)CCC1Br

Synonyms:

• (2-Bromo-5,5-dimethylcyclohex-1-en-1-yl)methanol
• 2-Bromo-5,5-dimethyl-1-cyclohexene-1-methanol
• 1-Cyclohexene-1-methanol, 2-bromo-5,5-dimethyl-

(2-broMo-5,5-diMethylcyclohex-1-en-1-yl)Methanol

CAS: 1053265-67-0

Formula: C₉H₁₅BrO

Purity: 95%

Molecular weight: 219.1188

Ref: IN-DA009LWI