
CAS 10533-09-2
:N-(2,5-Dimethylphenyl)cyanamide
Description:
N-(2,5-Dimethylphenyl)cyanamide is an organic compound characterized by the presence of a cyanamide functional group attached to a 2,5-dimethylphenyl moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of the cyanamide group imparts certain reactivity, making it useful in synthetic chemistry, particularly in the formation of other nitrogen-containing compounds. Its molecular structure contributes to its unique physical and chemical properties, such as solubility in organic solvents and stability under specific conditions. Additionally, the compound may exhibit biological activity, which can be of interest in drug development or as a pesticide. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, to ensure safe usage and compliance with regulatory standards. Overall, N-(2,5-Dimethylphenyl)cyanamide represents a versatile compound with significant potential in various chemical applications.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c1-7-3-4-8(2)9(5-7)11-6-10/h3-5,11H,1-2H3
InChI key:InChIKey=WUNUYNRRKONUTQ-UHFFFAOYSA-N
SMILES:N(C#N)C1=C(C)C=CC(C)=C1
Synonyms:- N-(2,5-Dimethylphenyl)cyanamide
- Cyanamide, N-(2,5-dimethylphenyl)-
- N-Cyano-2,5-dimethylaniline
- Cyanamide, (2,5-dimethylphenyl)-
- Carbanilonitrile, 2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.