CymitQuimica logo

CAS 105356-66-9

:

4-(3-Methoxy-phenyl)-2,4-dioxo-butyric acid

Description:
4-(3-Methoxy-phenyl)-2,4-dioxo-butyric acid, identified by its CAS number 105356-66-9, is an organic compound characterized by its unique molecular structure, which includes a butyric acid backbone with two keto groups and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with dioxo acids, such as acidity due to the carboxylic acid functional group and potential reactivity from the carbonyl groups. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 4-(3-Methoxy-phenyl)-2,4-dioxo-butyric acid represents a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H10O5
InChI:InChI=1/C11H10O5/c1-16-8-4-2-3-7(5-8)9(12)6-10(13)11(14)15/h2-5H,6H2,1H3,(H,14,15)
SMILES:COc1cccc(c1)C(=O)CC(=O)C(=O)O
Synonyms:
  • 4-(3-Methoxyphenyl)-2,4-dioxobutanoic acid
  • Benzenebutanoic Acid, 3-Methoxy-Alpha,Gamma-Dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.