CAS 105356-71-6

4-[4-(1H-IMIDAZOL-1-YL)PHENYL]-2,4-DIOXO-BUTANOIC ACID

Description:

4-[4-(1H-Imidazol-1-yl)phenyl]-2,4-dioxo-butanoic acid, with the CAS number 105356-71-6, is a chemical compound characterized by its complex structure that includes an imidazole ring and a dioxo-butanoic acid moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of functional groups. The imidazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The dioxo-butanoic acid component may impart acidity, influencing its reactivity and interactions with other molecules. Additionally, the compound may participate in hydrogen bonding due to the presence of carboxylic acid functionalities, which can affect its stability and solubility. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula: C₁₃H₁₀N₂O₄

InChI: InChI=1/C13H10N2O4/c16-11(7-12(17)13(18)19)9-1-3-10(4-2-9)15-6-5-14-8-15/h1-6,8H,7H2,(H,18,19)

SMILES: c1cc(ccc1C(=O)CC(=O)C(=O)O)n1ccnc1

Synonyms:

• 2,4-Dioxo-4-[4-(1H-imidazol-1-yl)]phenylbutanoic acid
• 4-benzylidene-2-methyl-1,3-oxazol-5(4H)-one
• 4-[4-(1H-IMIDAZOL-1-YL)PHENYL]-2,4-DIOXO-BUTANOIC ACID
• Benzenebutanoic acid, 4-(1H-imidazol-1-yl)-α,γ-dioxo-

2,4-Dioxo-4-[4-(1H-imidazol-1-yl)]phenylbutanoic acid

CAS: 105356-71-6

2,4-Dioxo-4-[4-(1H-imidazol-1-yl)]phenylbutanoic acid

Formula: C₁₃H₁₀N₂O₄

Purity: ≥95%

Color and Shape: pale yellow powder

Molecular weight: 258.23g/mol

Ref: 54-OR01524