CAS 105364-42-9
:(αR)-α-Methyl-4-(1-methylethyl)benzenemethanol
Description:
(αR)-α-Methyl-4-(1-methylethyl)benzenemethanol, also known as a specific isomer of a substituted phenolic compound, exhibits several notable characteristics. It features a chiral center, which contributes to its stereochemistry and potential biological activity. The compound contains a benzene ring substituted with a methyl group and an isopropyl group, which influences its hydrophobic properties and solubility in organic solvents. As a benzenemethanol derivative, it possesses a hydroxyl (-OH) functional group, which can participate in hydrogen bonding, enhancing its reactivity and potential interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its structural features that could affect its pharmacokinetics and biological activity. Additionally, the presence of the isopropyl group may impart steric hindrance, influencing its conformational dynamics. Overall, the unique structural attributes of (αR)-α-Methyl-4-(1-methylethyl)benzenemethanol make it a compound of interest for further study in chemical and biological applications.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-8(2)10-4-6-11(7-5-10)9(3)12/h4-9,12H,1-3H3/t9-/m1/s1
InChI key:InChIKey=LPWMXVJCBUKVQH-SECBINFHSA-N
SMILES:C(C)(C)C1=CC=C([C@@H](C)O)C=C1
Synonyms:- (1R)-1-(4-Propan-2-ylphenyl)ethanol
- (1R)-1-[4-(Propan-2-yl)phenyl]ethan-1-ol
- (R)-1-(4-isopropylphenyl)ethanol
- (αR)-α-Methyl-4-(1-methylethyl)benzenemethanol
- Benzenemethanol, α-methyl-4-(1-methylethyl)-, (R)-
- Benzenemethanol, α-methyl-4-(1-methylethyl)-, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.