CAS 105365-51-3
:B-(4-Butoxyphenyl)boronic acid
Description:
B-(4-Butoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a butoxyphenyl moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, while exhibiting limited solubility in water due to its hydrophobic butoxy group. It is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are pivotal for forming carbon-carbon bonds in the synthesis of complex organic molecules. The boronic acid group allows for reversible binding with diols, making it useful in various applications, including sensor technology and drug delivery systems. Additionally, B-(4-Butoxyphenyl)boronic acid may exhibit interesting electronic properties due to the conjugation between the boron atom and the aromatic ring, which can influence its reactivity and interaction with other chemical species. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential irritant properties.
Formula:C10H15BO3
InChI:InChI=1S/C10H15BO3/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7,12-13H,2-3,8H2,1H3
InChI key:InChIKey=QUPFQMXWFNJUNJ-UHFFFAOYSA-N
SMILES:O(CCCC)C1=CC=C(B(O)O)C=C1
Synonyms:- (4-N-Butoxyphenyl)boronic acid
- 4-Butoxycarbonylboronic Acid
- 4-Butoxymethylboronicacid
- 4-n-Butoxyphenylboronic acid
- Akos Brn-0163
- B-(4-Butoxyphenyl)boronic acid
- Boronic acid, (4-butoxyphenyl)-
- Boronic acid, B-(4-butoxyphenyl)-
- P-Butoxyphenylboronic acid
- 4-Butoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Butoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C10H15BO3Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:194.044-n-Butoxybenzeneboronic acid, 98%
CAS:Used as a reactant for Suzuki-Miyaura cross-coupling reactions, condensation reactions, synthesis of azobenzene-functionalized compounds. Also used for preparation of highly fluorescent diketopyrrolopyrrole derivatives, rhodium-catalyzed Suzuki-type cross-coupling and copper-catalyzed asymmetric conFormula:C10H15BO3Purity:98%Molecular weight:194.044-N-Butoxyphenylboronic acid
CAS:Formula:C10H15BO3Purity:98%Color and Shape:SolidMolecular weight:194.03534-(n-Butoxy)benzeneboronic acid
CAS:4-(n-Butoxy)benzeneboronic acidFormula:C10H15BO3Purity:≥95%Color and Shape: white to off-white solidMolecular weight:194.04g/mol4-N-Butoxyphenylboronic acid
CAS:Formula:C10H15BO3Purity:98%Color and Shape:SolidMolecular weight:194.04





