
CAS 1053655-62-1
:Phenyl[4-(4-quinazolinyl)-1-piperazinyl]methanone
Description:
Phenyl[4-(4-quinazolinyl)-1-piperazinyl]methanone, identified by its CAS number 1053655-62-1, is a synthetic organic compound characterized by its complex structure, which includes a phenyl group, a quinazoline moiety, and a piperazine ring. This compound typically exhibits properties associated with its heterocyclic components, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the quinazoline and piperazine structures suggests that it may interact with various biological targets, potentially influencing neurotransmitter systems or exhibiting anti-cancer properties. Its molecular structure allows for various functional group interactions, which can be crucial for its pharmacological efficacy. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, Phenyl[4-(4-quinazolinyl)-1-piperazinyl]methanone represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C19H18N4O
InChI:InChI=1S/C19H18N4O/c24-19(15-6-2-1-3-7-15)23-12-10-22(11-13-23)18-16-8-4-5-9-17(16)20-14-21-18/h1-9,14H,10-13H2
InChI key:InChIKey=OLYXJUQVSOBEPM-UHFFFAOYSA-N
SMILES:C(=O)(N1CCN(C=2C3=C(N=CN2)C=CC=C3)CC1)C4=CC=CC=C4
Synonyms:- Methanone, phenyl[4-(4-quinazolinyl)-1-piperazinyl]-
- Phenyl[4-(4-quinazolinyl)-1-piperazinyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.