CymitQuimica logo

CAS 1053655-64-3

:

3,4-Dihydro-4-oxo-8-quinazolinecarboxaldehyde

Description:
3,4-Dihydro-4-oxo-8-quinazolinecarboxaldehyde is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound features a carbonyl group (C=O) and an aldehyde group (–CHO), contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the 4-oxo group indicates that it has a ketone functionality, which can participate in various chemical reactions, such as nucleophilic additions. The compound's structure suggests it may exhibit biological activity, making it of interest in drug discovery and development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Additionally, the compound's unique functional groups may allow for further derivatization, enhancing its utility in synthesizing more complex molecules. Overall, 3,4-Dihydro-4-oxo-8-quinazolinecarboxaldehyde represents a versatile scaffold in the field of organic chemistry.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c12-4-6-2-1-3-7-8(6)10-5-11-9(7)13/h1-5H,(H,10,11,13)
InChI key:InChIKey=MWUSSNLJNRRHBK-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(C(=O)N=CN2)=CC=C1
Synonyms:
  • 8-Quinazolinecarboxaldehyde, 3,4-dihydro-4-oxo-
  • 3,4-Dihydro-4-oxo-8-quinazolinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.