CAS 1053655-68-7
:Methyl [1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
Description:
Methyl [1,2,4]triazolo[1,5-a]pyridine-5-carboxylate is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a methyl ester functional group, which contributes to its solubility and reactivity. The presence of the triazole ring imparts notable biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmacological agent. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for various substitution reactions, which can be exploited to modify its properties for specific applications. Additionally, the compound's interactions with biological targets can be influenced by its electronic and steric characteristics, making it a subject of study in drug design and development. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-13-8(12)6-3-2-4-7-9-5-10-11(6)7/h2-5H,1H3
InChI key:InChIKey=POXZQTIWHPDEKV-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N2C(C=CC1)=NC=N2
Synonyms:- [1,2,4]Triazolo[1,5-a]pyridine-5-carboxylic acid, methyl ester
- Methyl [1,2,4]triazolo[1,5-a]pyridine-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.