CAS 1053655-77-8

1,1-Dimethylethyl 2-[1-imino-2-(4-methoxyphenoxy)ethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[1-imino-2-(4-methoxyphenoxy)ethyl]hydrazinecarboxylate, with the CAS number 1053655-77-8, is a chemical compound characterized by its complex structure, which includes a hydrazinecarboxylate moiety and a methoxyphenoxy group. This compound typically exhibits properties associated with both hydrazine derivatives and ester functionalities, suggesting potential reactivity in various chemical environments. It may display moderate to high polarity due to the presence of polar functional groups, influencing its solubility in different solvents. The methoxyphenoxy group can contribute to its aromatic characteristics, potentially affecting its stability and reactivity. Additionally, compounds of this nature may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies. As with many chemical substances, proper handling and safety measures are essential when working with this compound in laboratory settings.

Formula: C₁₄H₂₁N₃O₄

InChI: InChI=1S/C14H21N3O4/c1-14(2,3)21-13(18)17-16-12(15)9-20-11-7-5-10(19-4)6-8-11/h5-8H,9H2,1-4H3,(H2,15,16)(H,17,18)

InChI key: InChIKey=BBHMGDULNTXIJP-UHFFFAOYSA-N

SMILES: O(CC(NNC(OC(C)(C)C)=O)=N)C1=CC=C(OC)C=C1

Synonyms:

• Hydrazinecarboxylic acid, 2-[1-imino-2-(4-methoxyphenoxy)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[1-imino-2-(4-methoxyphenoxy)ethyl]hydrazinecarboxylate

N'-[1-Amino-2-(4-methoxyphenoxy)ethylidene]hydrazinecarboxylic acid tert-butyl ester

CAS: 1053655-77-8

N'-[1-Amino-2-(4-methoxyphenoxy)ethylidene]hydrazinecarboxylic acid tert-butyl ester

Purity: 95%

Molecular weight: 295.33g/mol

Ref: 54-OR346007