CAS 1053655-83-6

1,1-Dimethylethyl 2-[2-(3-chlorophenoxy)-1-iminoethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[2-(3-chlorophenoxy)-1-iminoethyl]hydrazinecarboxylate, identified by its CAS number 1053655-83-6, is a chemical compound that features a hydrazinecarboxylate functional group, which is indicative of its potential reactivity and biological activity. This compound contains a 3-chlorophenoxy group, suggesting it may exhibit herbicidal or pesticidal properties, as chlorophenoxy derivatives are commonly associated with such applications. The presence of the dimethyl group contributes to its steric hindrance, potentially influencing its interaction with biological targets. Additionally, the iminoethyl moiety may enhance its reactivity, making it a candidate for further chemical transformations. The compound's structure suggests it may be soluble in organic solvents, but its solubility in water would depend on the specific functional groups and their interactions with water molecules. Overall, this compound's unique structural features may confer specific pharmacological or agrochemical properties, warranting further investigation into its potential applications in various fields.

Formula: C₁₃H₁₈ClN₃O₃

InChI: InChI=1S/C13H18ClN3O3/c1-13(2,3)20-12(18)17-16-11(15)8-19-10-6-4-5-9(14)7-10/h4-7H,8H2,1-3H3,(H2,15,16)(H,17,18)

InChI key: InChIKey=RDEOMXSPCUISMT-UHFFFAOYSA-N

SMILES: O(CC(NNC(OC(C)(C)C)=O)=N)C1=CC(Cl)=CC=C1

Synonyms:

• Hydrazinecarboxylic acid, 2-[2-(3-chlorophenoxy)-1-iminoethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[2-(3-chlorophenoxy)-1-iminoethyl]hydrazinecarboxylate

N'-[1-Amino-2-(3-chlorophenoxy)ethylidene]hydrazinecarboxylic acid tert-butyl ester

CAS: 1053655-83-6

N'-[1-Amino-2-(3-chlorophenoxy)ethylidene]hydrazinecarboxylic acid tert-butyl ester

Purity: 95%

Molecular weight: 299.75g/mol

Ref: 54-OR346010