CAS 1053655-92-7

2,3-Dihydro-1-methyl-2-oxo-1H-indole-4-carboxaldehyde

Description:

2,3-Dihydro-1-methyl-2-oxo-1H-indole-4-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a carbonyl group (ketone) and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group and the specific positioning of the carbonyl and aldehyde functionalities influence its chemical behavior, making it a candidate for various chemical reactions, including condensation and oxidation. It may exhibit biological activity, which could be of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability in different solvents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of reactive functional groups. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c1-11-9-4-2-3-7(6-12)8(9)5-10(11)13/h2-4,6H,5H2,1H3

InChI key: InChIKey=FCAODJVDVCDYMX-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(N(C)C(=O)C2)=CC=C1

Synonyms:

• 1H-Indole-4-carboxaldehyde, 2,3-dihydro-1-methyl-2-oxo-
• 2,3-Dihydro-1-methyl-2-oxo-1H-indole-4-carboxaldehyde