CAS 1053656-02-2

1,1-Dimethylethyl 2-[2-(2,6-dichlorophenyl)-1-iminoethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[2-(2,6-dichlorophenyl)-1-iminoethyl]hydrazinecarboxylate, identified by its CAS number 1053656-02-2, is a chemical compound that features a complex structure incorporating a hydrazinecarboxylate moiety. This substance is characterized by the presence of a dimethyl group, which contributes to its steric properties, and a dichlorophenyl group that may influence its reactivity and biological activity. The iminoethyl group suggests potential for nucleophilic interactions, making it of interest in various chemical reactions. The compound may exhibit specific solubility characteristics depending on the solvent, and its stability can be influenced by environmental factors such as temperature and pH. Additionally, due to the presence of chlorine atoms, it may possess unique electronic properties that could affect its behavior in biological systems. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities and safety profiles would require further investigation.

Formula: C₁₃H₁₇Cl₂N₃O₂

InChI: InChI=1S/C13H17Cl2N3O2/c1-13(2,3)20-12(19)18-17-11(16)7-8-9(14)5-4-6-10(8)15/h4-6H,7H2,1-3H3,(H2,16,17)(H,18,19)

InChI key: InChIKey=CRHXILHGLNMGHN-UHFFFAOYSA-N

SMILES: C(C(NNC(OC(C)(C)C)=O)=N)C1=C(Cl)C=CC=C1Cl

Synonyms:

• 1,1-Dimethylethyl 2-[2-(2,6-dichlorophenyl)-1-iminoethyl]hydrazinecarboxylate
• Hydrazinecarboxylic acid, 2-[2-(2,6-dichlorophenyl)-1-iminoethyl]-, 1,1-dimethylethyl ester

N'-[1-Amino-2-(2,6-dichlorophenyl)ethylidene]hydrazinecarboxylic acid tert-butyl ester

CAS: 1053656-02-2

N'-[1-Amino-2-(2,6-dichlorophenyl)ethylidene]hydrazinecarboxylic acid tert-butyl ester

Purity: 95%

Molecular weight: 318.20g/mol

Ref: 54-OR346014