CAS 1053656-03-3

2-Chloro-4-(3-pyridinyl)-1,3,5-triazine

Description:

2-Chloro-4-(3-pyridinyl)-1,3,5-triazine is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. The presence of a chlorine atom at the 2-position and a pyridine ring at the 4-position contributes to its unique chemical properties. This compound is typically a white to light yellow solid and is soluble in organic solvents. It exhibits potential biological activity, making it of interest in pharmaceutical and agrochemical research. The triazine moiety is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit herbicidal or fungicidal properties, which are common in triazine derivatives. Its molecular structure allows for interactions with biological targets, making it a candidate for further investigation in drug development. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₈H₅ClN₄

InChI: InChI=1S/C8H5ClN4/c9-8-12-5-11-7(13-8)6-2-1-3-10-4-6/h1-5H

InChI key: InChIKey=ICCJPZWJQCTSHD-UHFFFAOYSA-N

SMILES: ClC1=NC(=NC=N1)C=2C=CC=NC2

Synonyms:

• 1,3,5-Triazine, 2-chloro-4-(3-pyridinyl)-
• 2-Chloro-4-(3-pyridinyl)-1,3,5-triazine