
CAS 1053656-13-5
:2-(Aminomethyl)-5,6,7,8-tetrahydro-4(3H)-quinazolinone
Description:
2-(Aminomethyl)-5,6,7,8-tetrahydro-4(3H)-quinazolinone is a chemical compound characterized by its unique bicyclic structure, which includes a quinazolinone moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an aminomethyl group that contributes to its reactivity and potential biological activity. The molecular structure suggests it may exhibit properties typical of heterocyclic compounds, including the ability to participate in hydrogen bonding and interactions with biological targets. Its potential applications could span various fields, including medicinal chemistry, where it may serve as a lead compound for drug development due to its structural features that may influence pharmacological activity. Additionally, the presence of the amino group may enhance solubility and bioavailability. As with many quinazolinone derivatives, it may also exhibit a range of biological activities, including anti-inflammatory, analgesic, or antitumor effects, making it a subject of interest in pharmaceutical research. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-5-8-11-7-4-2-1-3-6(7)9(13)12-8/h1-5,10H2,(H,11,12,13)
InChI key:InChIKey=NCIGYYMJDYSIRK-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(CN)=N1)CCCC2
Synonyms:- 4(3H)-Quinazolinone, 2-(aminomethyl)-5,6,7,8-tetrahydro-
- 2-(Aminomethyl)-5,6,7,8-tetrahydro-4(3H)-quinazolinone
- 2-(Aminomethyl)-3,4,5,6,7,8-hexahydroquinazolin-4-one
- 2-(Aminomethyl)-5,6,7,8-tetrahydroquinazolin-4-ol
- 2-(Aminomethyl)-5,6,7,8-tetrahydroquinazolin-4(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.