CAS 1053656-21-5

Ethyl 5-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]methyl]-3-isoxazolecarboxylate

Description:

Ethyl 5-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]methyl]-3-isoxazolecarboxylate is a synthetic organic compound characterized by its complex structure, which includes an isoxazole ring, a piperidine moiety, and an ethyl ester functional group. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carboxylate and amine. The isoxazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the dimethylethoxycarbonyl group suggests that it may be involved in various chemical reactions, including acylation or amidation. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further research in drug development or other applications in organic synthesis. However, detailed studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₁₇H₂₇N₃O₅

InChI: InChI=1S/C17H27N3O5/c1-5-23-15(21)14-10-13(25-19-14)11-20-8-6-12(7-9-20)18-16(22)24-17(2,3)4/h10,12H,5-9,11H2,1-4H3,(H,18,22)

InChI key: InChIKey=WRMOPCAPINIZMD-UHFFFAOYSA-N

SMILES: C(C1=CC(C(OCC)=O)=NO1)N2CCC(NC(OC(C)(C)C)=O)CC2

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]methyl]-, ethyl ester
• Ethyl 5-[[4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]methyl]-3-isoxazolecarboxylate

Ethyl 5-(4-tert-butoxycarbonylaminopiperidin-1-ylmethyl)isoxazole-3-carboxylate

CAS: 1053656-21-5

Formula: C₁₇H₂₇N₃O₅

Purity: 95.0%

Molecular weight: 353.419

Ref: 10-F316446