CAS 1053656-33-9

1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid, ethyl ester

Description:

1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid, ethyl ester, is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a carboxylic acid functional group that is esterified with an ethyl group, contributing to its solubility and reactivity. It typically appears as a crystalline solid and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the pyrazolo and pyridine moieties suggests that it may exhibit diverse pharmacological properties, including anti-inflammatory or antimicrobial effects. Its molecular structure allows for various chemical modifications, which can enhance its biological efficacy or alter its physicochemical properties. The compound is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances, to avoid any potential hazards. Its applications may extend to drug development, where it serves as a scaffold for synthesizing novel therapeutic agents.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-2-14-9(13)8-6-3-4-10-5-7(6)11-12-8/h3-5H,2H2,1H3,(H,11,12)

InChI key: InChIKey=DEBPRNDMJGKCBA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=2C(NN1)=CN=CC2

Synonyms:

• 1H-Pyrazolo[3,4-c]pyridine-3-carboxylic acid, ethyl ester
• ethyl 1H-pyrazolo[3,4-c]pyridine-3-carboxylate

1H-Pyrazolo[3,4-c]pyridine-3-carboxylicacid, ethyl ester

CAS: 1053656-33-9

Formula: C₉H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.1867

Ref: IN-DA00852M

Ethyl 1H-pyrazolo[3,4-c]pyridine-3-carboxylate

CAS: 1053656-33-9

Ethyl 1H-pyrazolo[3,4-c]pyridine-3-carboxylate

Purity: 98%

Molecular weight: 191.19g/mol

Ref: 54-OR301224

ETHYL 1H-PYRAZOLO[3,4-C]PYRIDINE-3-CARBOXYLATE

CAS: 1053656-33-9

Purity: 98%

Molecular weight: 191.1900024

Ref: 10-F857264