CAS 1053656-34-0
:Ethyl 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate
Description:
Ethyl 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 3,4-dichlorophenyl substituent enhances its biological activity and may influence its solubility and stability. Typically, compounds of this nature are investigated for their potential as pharmaceuticals or agrochemicals due to their ability to interact with biological systems. The molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for studies in medicinal chemistry or materials science. Additionally, the compound's specific characteristics, such as melting point, boiling point, and solubility, would be determined through experimental methods, which are essential for understanding its behavior in various environments. Overall, this compound represents a class of heterocyclic compounds with diverse applications in chemical research.
Formula:C11H8Cl2N2O3
InChI:InChI=1S/C11H8Cl2N2O3/c1-2-17-11(16)10-14-9(15-18-10)6-3-4-7(12)8(13)5-6/h3-5H,2H2,1H3
InChI key:InChIKey=YSZRWQDAUWLLJD-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- Ethyl 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate
- 1,2,4-Oxadiazole-5-carboxylic acid, 3-(3,4-dichlorophenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.