CAS 1053656-44-2

2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid

Description:

2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, along with a thioacetic acid moiety. This compound is typically classified as a thioether and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the trifluoromethyl group enhances lipophilicity and biological activity, while the thioether linkage may contribute to its reactivity and interaction with biological targets. The compound's molecular structure suggests it may exhibit specific properties such as solubility in organic solvents and potential reactivity with electrophiles. Additionally, the chlorine substituent can influence the compound's electronic properties and stability. Overall, 2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid represents a class of compounds that may be of interest for further research in chemical synthesis and pharmacology.

Formula: C₈H₅ClF₃NO₂S

InChI: InChI=1S/C8H5ClF3NO2S/c9-5-1-4(8(10,11)12)2-6(13-5)16-3-7(14)15/h1-2H,3H2,(H,14,15)

InChI key: InChIKey=PQZNOFRSZMJZHD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(SCC(O)=O)N=C(Cl)C1

Synonyms:

• 2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid
• Acetic acid, 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]thio]-

2-[[6-Chloro-4-(trifluoromethyl)pyridin-2-yl]sulfanyl]acetic acid

CAS: 1053656-44-2

2-[[6-Chloro-4-(trifluoromethyl)pyridin-2-yl]sulfanyl]acetic acid

Purity: 95%

Molecular weight: 271.64g/mol

Ref: 54-PC400630

2-(6-Chloro-4-(trifluoromethyl)pyridin-2-ylsulfanyl)acetic acid

CAS: 1053656-44-2

Formula: C₈H₅ClF₃NO₂S

Purity: 95.0%

Molecular weight: 271.64

Ref: 10-F047308