CAS 1053656-45-3: 1-Chloro-7-nitropyrrolo[1,2-a]pyrazine
Description:1-Chloro-7-nitropyrrolo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrazine moieties. The presence of a chlorine atom and a nitro group at specific positions on the ring system contributes to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound typically exhibits moderate solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro group and the halogen substituent. The compound may participate in electrophilic substitution reactions, nucleophilic attacks, and other transformations typical of nitrogen-containing heterocycles. Its structural features suggest potential biological activity, making it a candidate for further investigation in drug development. Additionally, the compound's stability and reactivity profile can be affected by environmental conditions, such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C7H4ClN3O2
InChI:InChI=1S/C7H4ClN3O2/c8-7-6-3-5(11(12)13)4-10(6)2-1-9-7/h1-4H
InChI key:InChIKey=OTWHUHVUMPHTOY-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=C2C(Cl)=NC=CN2C1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-CHLORO-7-NITROH-PYRROLO[1,2-A]PYRAZINE REF: IN-DA008RNRCAS: 1053656-45-3 | - - - | To inquire | Fri 07 Mar 25 |
![]() | 1-Chloro-7-nitropyrrolo[1,2-a]pyrazine REF: 10-F093212CAS: 1053656-45-3 | 95.0% | To inquire | Mon 17 Mar 25 |
![]() | 1-Chloro-7-nitropyrrolo[1,2-a]pyrazine REF: 3D-FC142116CAS: 1053656-45-3 | Min. 95% | - - - | Discontinued product |

1-Chloro-7-nitropyrrolo[1,2-a]pyrazine
Ref: 10-F093212
1g | 1,397.00 € | ||
250mg | To inquire |

1-Chloro-7-nitropyrrolo[1,2-a]pyrazine
Ref: 3D-FC142116
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |