CAS 1053656-58-8

1,1-Dimethylethyl N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate, identified by its CAS number 1053656-58-8, is a chemical compound characterized by its unique structure, which includes a carbamate functional group and an oxadiazole moiety. This compound typically exhibits properties associated with both the carbamate and oxadiazole classes, such as potential biological activity and stability under various conditions. The presence of the dimethyl group contributes to its steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the 4-methylphenyl substituent can enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Such compounds are often investigated for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific characteristics such as melting point, boiling point, solubility, and toxicity would require empirical data for precise evaluation. Overall, this compound represents a complex structure with potential utility in various chemical and biological applications.

Formula: C₁₅H₁₉N₃O₃

InChI: InChI=1S/C15H19N3O3/c1-10-5-7-11(8-6-10)13-18-17-12(20-13)9-16-14(19)21-15(2,3)4/h5-8H,9H2,1-4H3,(H,16,19)

InChI key: InChIKey=ZEJVNWQDNRCBJR-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C=1OC(=NN1)C2=CC=C(C)C=C2

Synonyms:

• 1,1-Dimethylethyl N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate
• Carbamic acid, N-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-, 1,1-dimethylethyl ester