CAS 1053656-61-3

1,1-Dimethylethyl N-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate, identified by its CAS number 1053656-61-3, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and an oxadiazole moiety. This compound typically exhibits properties associated with both the carbamate and oxadiazole classes, such as potential biological activity and stability under various conditions. The presence of the dichlorophenyl group suggests that it may possess significant lipophilicity, which can influence its solubility and interaction with biological systems. Additionally, the oxadiazole ring is known for its role in pharmaceuticals and agrochemicals, often contributing to the compound's efficacy as a pesticide or herbicide. The compound's synthesis and application may be of interest in fields such as medicinal chemistry and agricultural science, where its unique structural features could lead to novel therapeutic or protective agents. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated aromatic compounds.

Formula: C₁₄H₁₅Cl₂N₃O₃

InChI: InChI=1S/C14H15Cl2N3O3/c1-14(2,3)22-13(20)17-7-11-18-19-12(21-11)8-4-5-9(15)10(16)6-8/h4-6H,7H2,1-3H3,(H,17,20)

InChI key: InChIKey=XKMNEGYJJCIEPO-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C=1OC(=NN1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 1,1-Dimethylethyl N-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]carbamate
• Carbamic acid, N-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-, 1,1-dimethylethyl ester

2-tert-Butyloxycarbonylaminomethyl-5-(3,4-dichlorophenyl)-[1,3,4]oxadiazole

CAS: 1053656-61-3

Formula: C₁₄H₁₅Cl₂N₃O₃

Purity: 95.0%

Molecular weight: 344.19

Ref: 10-F316341