CymitQuimica logo

CAS 1053656-63-5

:

Ethyl 5,7-dichloro-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylate

Description:
Ethyl 5,7-dichloro-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two chlorine substituents at the 5 and 7 positions, contributing to its reactivity and potential biological activity. The ethyl ester functional group at the carboxylate position enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and agrochemicals. The presence of halogen atoms often influences the compound's pharmacological properties, including its ability to interact with biological targets. Additionally, the compound may exhibit interesting properties such as antimicrobial or antitumor activity, which are common in similar heterocyclic compounds. Its molecular structure allows for potential modifications that can lead to the development of derivatives with enhanced efficacy or selectivity. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C8H6Cl2N4O2
InChI:InChI=1S/C8H6Cl2N4O2/c1-2-16-7(15)5-3-4(13-14-5)6(9)12-8(10)11-3/h2H2,1H3,(H,13,14)
InChI key:InChIKey=XCTJYEKMWZSXFV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NN1)=C(Cl)N=C(Cl)N2
Synonyms:
  • 1H-Pyrazolo[4,3-d]pyrimidine-3-carboxylic acid, 5,7-dichloro-, ethyl ester
  • Ethyl 5,7-dichloro-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.