CAS 1053656-82-8

2-[(3-Methoxyphenyl)methyl]-4-thiazoleacetic acid

Description:

2-[(3-Methoxyphenyl)methyl]-4-thiazoleacetic acid, identified by its CAS number 1053656-82-8, is a chemical compound characterized by its thiazole and aromatic functionalities. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its potential biological activity. The presence of the 3-methoxyphenyl group indicates that it has a methoxy substituent on a phenyl ring, which can influence its solubility and reactivity. The carboxylic acid functional group (-COOH) at the thiazole position suggests that it may exhibit acidic properties and participate in hydrogen bonding, enhancing its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological activities. Overall, its unique combination of heterocyclic and aromatic components positions it as a potentially valuable compound for further research in drug development and related fields.

Formula: C₁₃H₁₃NO₃S

InChI: InChI=1S/C13H13NO3S/c1-17-11-4-2-3-9(5-11)6-12-14-10(8-18-12)7-13(15)16/h2-5,8H,6-7H2,1H3,(H,15,16)

InChI key: InChIKey=NGVJJXWBEWGFKO-UHFFFAOYSA-N

SMILES: C(C1=NC(CC(O)=O)=CS1)C2=CC(OC)=CC=C2

Synonyms:

• 4-Thiazoleacetic acid, 2-[(3-methoxyphenyl)methyl]-
• 2-[(3-Methoxyphenyl)methyl]-4-thiazoleacetic acid

[2-(3-Methoxybenzyl)-1,3-thiazol-4-yl]acetic acid

CAS: 1053656-82-8

Formula: C₁₃H₁₃NO₃S

Purity: 97.0%

Molecular weight: 263.31

Ref: 10-F066179